C24H21FN2O4 — CID 166205977
[1-(3-methylanilino)-1-oxopropan-2-yl] (E)-3-(3-fluoro-4-pyridin-3-yloxyphenyl)prop-2-enoate (PubChem CID 166205977) has the molecular formula C24H21FN2O4 and a molecular weight of 420.44 g/mol. Its IUPAC name is [1-(3-methylanilino)-1-oxopropan-2-yl] (E)-3-(3-fluoro-4-pyridin-3-yloxyphenyl)prop-2-enoate.
| Compound Name | [1-(3-methylanilino)-1-oxopropan-2-yl] (E)-3-(3-fluoro-4-pyridin-3-yloxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 166205977 |
| Molecular Formula | C24H21FN2O4 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [1-(3-methylanilino)-1-oxopropan-2-yl] (E)-3-(3-fluoro-4-pyridin-3-yloxyphenyl)prop-2-enoate |
| SMILES | Cc1cccc(NC(=O)C(C)OC(=O)/C=C/c2ccc(Oc3cccnc3)c(F)c2)c1 |
| InChI | InChI=1S/C24H21FN2O4/c1-16-5-3-6-19(13-16)27-24(29)17(2)30-23(28)11-9-18-8-10-22(21(25)14-18)31-20-7-4-12-26-15-20/h3-15,17H,1-2H3,(H,27,29)/b11-9+ |
| InChIKey | QIQGTYOAOSFGHF-PKNBQFBNSA-N |
| XLogP | 4.91 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|