C23H19F3N2O3 — CID 166229813
(E)-N-[1-(2,6-difluorophenyl)-1-hydroxypropan-2-yl]-3-(3-fluoro-4-pyridin-3-yloxyphenyl)prop-2-enamide (PubChem CID 166229813) has the molecular formula C23H19F3N2O3 and a molecular weight of 428.41 g/mol. Its IUPAC name is (E)-N-[1-(2,6-difluorophenyl)-1-hydroxypropan-2-yl]-3-(3-fluoro-4-pyridin-3-yloxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-(2,6-difluorophenyl)-1-hydroxypropan-2-yl]-3-(3-fluoro-4-pyridin-3-yloxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 166229813 |
| Molecular Formula | C23H19F3N2O3 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (E)-N-[1-(2,6-difluorophenyl)-1-hydroxypropan-2-yl]-3-(3-fluoro-4-pyridin-3-yloxyphenyl)prop-2-enamide |
| SMILES | CC(NC(=O)/C=C/c1ccc(Oc2cccnc2)c(F)c1)C(O)c1c(F)cccc1F |
| InChI | InChI=1S/C23H19F3N2O3/c1-14(23(30)22-17(24)5-2-6-18(22)25)28-21(29)10-8-15-7-9-20(19(26)12-15)31-16-4-3-11-27-13-16/h2-14,23,30H,1H3,(H,28,29)/b10-8+ |
| InChIKey | GLQFWPCVYLRULN-CSKARUKUSA-N |
| XLogP | 4.54 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|