C23H24FN3O3 — CID 56511102
(E)-1-[4-(cyclobutanecarbonyl)piperazin-1-yl]-3-(3-fluoro-4-pyridin-3-yloxyphenyl)prop-2-en-1-one (PubChem CID 56511102) has the molecular formula C23H24FN3O3 and a molecular weight of 409.46 g/mol. Its IUPAC name is (E)-1-[4-(cyclobutanecarbonyl)piperazin-1-yl]-3-(3-fluoro-4-pyridin-3-yloxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(cyclobutanecarbonyl)piperazin-1-yl]-3-(3-fluoro-4-pyridin-3-yloxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 56511102 |
| Molecular Formula | C23H24FN3O3 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (E)-1-[4-(cyclobutanecarbonyl)piperazin-1-yl]-3-(3-fluoro-4-pyridin-3-yloxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Oc2cccnc2)c(F)c1)N1CCN(C(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C23H24FN3O3/c24-20-15-17(6-8-21(20)30-19-5-2-10-25-16-19)7-9-22(28)26-11-13-27(14-12-26)23(29)18-3-1-4-18/h2,5-10,15-16,18H,1,3-4,11-14H2/b9-7+ |
| InChIKey | RREGZHZAZPDAAE-VQHVLOKHSA-N |
| XLogP | 3.50 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|