C21H26F2N2O3 — CID 170156633
(E)-3-(3,4-difluorophenyl)-1-[4-(4-methoxycyclohexanecarbonyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 170156633) has the molecular formula C21H26F2N2O3 and a molecular weight of 392.45 g/mol. Its IUPAC name is (E)-3-(3,4-difluorophenyl)-1-[4-(4-methoxycyclohexanecarbonyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-difluorophenyl)-1-[4-(4-methoxycyclohexanecarbonyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170156633 |
| Molecular Formula | C21H26F2N2O3 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | (E)-3-(3,4-difluorophenyl)-1-[4-(4-methoxycyclohexanecarbonyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | COC1CCC(C(=O)N2CCN(C(=O)/C=C/c3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C21H26F2N2O3/c1-28-17-6-4-16(5-7-17)21(27)25-12-10-24(11-13-25)20(26)9-3-15-2-8-18(22)19(23)14-15/h2-3,8-9,14,16-17H,4-7,10-13H2,1H3/b9-3+ |
| InChIKey | PYDCKWFHCAIADH-YCRREMRBSA-N |
| XLogP | 2.85 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|