C23H31N3O2 — CID 17418117
(E)-3-[4-(azepan-1-yl)phenyl]-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 17418117) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is (E)-3-[4-(azepan-1-yl)phenyl]-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[4-(azepan-1-yl)phenyl]-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 17418117 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | (E)-3-[4-(azepan-1-yl)phenyl]-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(N2CCCCCC2)cc1)N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C23H31N3O2/c27-22(25-15-17-26(18-16-25)23(28)20-8-9-20)12-7-19-5-10-21(11-6-19)24-13-3-1-2-4-14-24/h5-7,10-12,20H,1-4,8-9,13-18H2/b12-7+ |
| InChIKey | AGENZQQSWQZNMN-KPKJPENVSA-N |
| XLogP | 3.16 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|