C22H23N3O4 — CID 166206465
N-ethyl-N'-[4-methoxy-3-(quinolin-2-ylmethoxy)phenyl]propanediamide (PubChem CID 166206465) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-ethyl-N'-[4-methoxy-3-(quinolin-2-ylmethoxy)phenyl]propanediamide.
| Compound Name | N-ethyl-N'-[4-methoxy-3-(quinolin-2-ylmethoxy)phenyl]propanediamide |
|---|---|
| PubChem CID | 166206465 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-ethyl-N'-[4-methoxy-3-(quinolin-2-ylmethoxy)phenyl]propanediamide |
| SMILES | CCNC(=O)CC(=O)Nc1ccc(OC)c(OCc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C22H23N3O4/c1-3-23-21(26)13-22(27)25-16-10-11-19(28-2)20(12-16)29-14-17-9-8-15-6-4-5-7-18(15)24-17/h4-12H,3,13-14H2,1-2H3,(H,23,26)(H,25,27) |
| InChIKey | YWUYXALCUZJVPQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|