C34H30N2O5 — CID 70388723
3-methoxy-4-(quinolin-2-ylmethoxy)phenol;3-methyl-4-(quinolin-2-ylmethoxy)phenol (PubChem CID 70388723) has the molecular formula C34H30N2O5 and a molecular weight of 546.62 g/mol. Its IUPAC name is 3-methoxy-4-(quinolin-2-ylmethoxy)phenol;3-methyl-4-(quinolin-2-ylmethoxy)phenol.
| Compound Name | 3-methoxy-4-(quinolin-2-ylmethoxy)phenol;3-methyl-4-(quinolin-2-ylmethoxy)phenol |
|---|---|
| PubChem CID | 70388723 |
| Molecular Formula | C34H30N2O5 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | 3-methoxy-4-(quinolin-2-ylmethoxy)phenol;3-methyl-4-(quinolin-2-ylmethoxy)phenol |
| SMILES | COc1cc(O)ccc1OCc1ccc2ccccc2n1.Cc1cc(O)ccc1OCc1ccc2ccccc2n1 |
| InChI | InChI=1S/C17H15NO3.C17H15NO2/c1-20-17-10-14(19)8-9-16(17)21-11-13-7-6-12-4-2-3-5-15(12)18-13;1-12-10-15(19)8-9-17(12)20-11-14-7-6-13-4-2-3-5-16(13)18-14/h2-10,19H,11H2,1H3;2-10,19H,11H2,1H3 |
| InChIKey | HWHNMDDSRBUKOE-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |