C24H33N5O3S — CID 166207451
1-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea (PubChem CID 166207451) has the molecular formula C24H33N5O3S and a molecular weight of 471.63 g/mol. Its IUPAC name is 1-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea.
| Compound Name | 1-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 166207451 |
| Molecular Formula | C24H33N5O3S |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 1-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(NC(=O)NCc2ccnc(N3CCCC3)c2)cc1 |
| InChI | InChI=1S/C24H33N5O3S/c1-28(21-7-3-2-4-8-21)33(31,32)22-11-9-20(10-12-22)27-24(30)26-18-19-13-14-25-23(17-19)29-15-5-6-16-29/h9-14,17,21H,2-8,15-16,18H2,1H3,(H2,26,27,30) |
| InChIKey | VUIHHRVZRUXYOF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |