C25H33N3O2 — CID 166208823
N-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-5-methyl-2-pyrrolidin-1-ylbenzamide (PubChem CID 166208823) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-5-methyl-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-5-methyl-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 166208823 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-5-methyl-2-pyrrolidin-1-ylbenzamide |
| SMILES | COc1cccc(C(CNC(=O)c2cc(C)ccc2N2CCCC2)N2CCCC2)c1 |
| InChI | InChI=1S/C25H33N3O2/c1-19-10-11-23(27-12-3-4-13-27)22(16-19)25(29)26-18-24(28-14-5-6-15-28)20-8-7-9-21(17-20)30-2/h7-11,16-17,24H,3-6,12-15,18H2,1-2H3,(H,26,29) |
| InChIKey | LDVVQOPVVUHFSC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |