C23H28N2O2 — CID 166209562
3-[[3-[[(1-hydroxycycloheptyl)methylamino]methyl]phenoxy]methyl]benzonitrile (PubChem CID 166209562) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 3-[[3-[[(1-hydroxycycloheptyl)methylamino]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 3-[[3-[[(1-hydroxycycloheptyl)methylamino]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 166209562 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 3-[[3-[[(1-hydroxycycloheptyl)methylamino]methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1cccc(COc2cccc(CNCC3(O)CCCCCC3)c2)c1 |
| InChI | InChI=1S/C23H28N2O2/c24-15-19-7-5-9-21(13-19)17-27-22-10-6-8-20(14-22)16-25-18-23(26)11-3-1-2-4-12-23/h5-10,13-14,25-26H,1-4,11-12,16-18H2 |
| InChIKey | HHLQUPPEEKANSH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |