C20H20N2O3 — CID 110907346
N-[3-[(3-cyanophenyl)methoxy]phenyl]-1-hydroxycyclopentane-1-carboxamide (PubChem CID 110907346) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-[3-[(3-cyanophenyl)methoxy]phenyl]-1-hydroxycyclopentane-1-carboxamide.
| Compound Name | N-[3-[(3-cyanophenyl)methoxy]phenyl]-1-hydroxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 110907346 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-[3-[(3-cyanophenyl)methoxy]phenyl]-1-hydroxycyclopentane-1-carboxamide |
| SMILES | N#Cc1cccc(COc2cccc(NC(=O)C3(O)CCCC3)c2)c1 |
| InChI | InChI=1S/C20H20N2O3/c21-13-15-5-3-6-16(11-15)14-25-18-8-4-7-17(12-18)22-19(23)20(24)9-1-2-10-20/h3-8,11-12,24H,1-2,9-10,14H2,(H,22,23) |
| InChIKey | GEUMCLXDNFPSRY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |