C23H20N2O2 — CID 39501116
N-[3-[(3-cyanophenyl)methoxy]phenyl]-2,4-dimethylbenzamide (PubChem CID 39501116) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[3-[(3-cyanophenyl)methoxy]phenyl]-2,4-dimethylbenzamide.
| Compound Name | N-[3-[(3-cyanophenyl)methoxy]phenyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 39501116 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-[3-[(3-cyanophenyl)methoxy]phenyl]-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(OCc3cccc(C#N)c3)c2)c(C)c1 |
| InChI | InChI=1S/C23H20N2O2/c1-16-9-10-22(17(2)11-16)23(26)25-20-7-4-8-21(13-20)27-15-19-6-3-5-18(12-19)14-24/h3-13H,15H2,1-2H3,(H,25,26) |
| InChIKey | LGHSEILWWFKMLF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |