C25H26N4O4 — CID 39500283
N-[3-[(3-cyanophenyl)methoxy]phenyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 39500283) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[3-[(3-cyanophenyl)methoxy]phenyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[3-[(3-cyanophenyl)methoxy]phenyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 39500283 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[3-[(3-cyanophenyl)methoxy]phenyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CN1C(=O)N(CC(=O)Nc2cccc(OCc3cccc(C#N)c3)c2)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C25H26N4O4/c1-28-24(32)29(23(31)25(28)11-3-2-4-12-25)16-22(30)27-20-9-6-10-21(14-20)33-17-19-8-5-7-18(13-19)15-26/h5-10,13-14H,2-4,11-12,16-17H2,1H3,(H,27,30) |
| InChIKey | GRUUPTKJXYRTOY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|