C25H29N3O4 — CID 39509040
2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[[4-(phenoxymethyl)phenyl]methyl]acetamide (PubChem CID 39509040) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[[4-(phenoxymethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[[4-(phenoxymethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 39509040 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[[4-(phenoxymethyl)phenyl]methyl]acetamide |
| SMILES | CN1C(=O)N(CC(=O)NCc2ccc(COc3ccccc3)cc2)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C25H29N3O4/c1-27-24(31)28(23(30)25(27)14-6-3-7-15-25)17-22(29)26-16-19-10-12-20(13-11-19)18-32-21-8-4-2-5-9-21/h2,4-5,8-13H,3,6-7,14-18H2,1H3,(H,26,29) |
| InChIKey | PDDCJJAQSSQRPP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|