C21H31N5O3 — CID 55743446
N-[[6-(diethylamino)-3-pyridinyl]methyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 55743446) has the molecular formula C21H31N5O3 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-[[6-(diethylamino)-3-pyridinyl]methyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[[6-(diethylamino)-3-pyridinyl]methyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 55743446 |
| Molecular Formula | C21H31N5O3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | N-[[6-(diethylamino)-3-pyridinyl]methyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)CN2C(=O)N(C)C3(CCCCC3)C2=O)cn1 |
| InChI | InChI=1S/C21H31N5O3/c1-4-25(5-2)17-10-9-16(13-22-17)14-23-18(27)15-26-19(28)21(24(3)20(26)29)11-7-6-8-12-21/h9-10,13H,4-8,11-12,14-15H2,1-3H3,(H,23,27) |
| InChIKey | BZTIOTDEWULYRC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|