About [(1R,4S)-4-[[1-(4-ethylphenyl)-2-morpholin-4-ylethyl]amino]cyclopent-2-en-1-yl]methanol
[(1R,4S)-4-[[1-(4-ethylphenyl)-2-morpholin-4-ylethyl]amino]cyclopent-2-en-1-yl]methanol (PubChem CID 166210498) has the molecular formula C20H30N2O2
and a molecular weight of 330.47 g/mol. Its IUPAC name is [(1R,4S)-4-[[1-(4-ethylphenyl)-2-morpholin-4-ylethyl]amino]cyclopent-2-en-1-yl]methanol.
Molecular Properties
| Compound Name | [(1R,4S)-4-[[1-(4-ethylphenyl)-2-morpholin-4-ylethyl]amino]cyclopent-2-en-1-yl]methanol |
| PubChem CID | 166210498 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | [(1R,4S)-4-[[1-(4-ethylphenyl)-2-morpholin-4-ylethyl]amino]cyclopent-2-en-1-yl]methanol |
| SMILES | CCc1ccc(C(CN2CCOCC2)N[C@@H]2C=C[C@H](CO)C2)cc1 |
| InChI | InChI=1S/C20H30N2O2/c1-2-16-3-6-18(7-4-16)20(14-22-9-11-24-12-10-22)21-19-8-5-17(13-19)15-23/h3-8,17,19-21,23H,2,9-15H2,1H3/t17-,19+,20?/m0/s1 |
| InChIKey | DUURDJSUUWPYEX-XRRBNZLQSA-N |
| XLogP | 2.15 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,4S)-4-[[1-(4-ethylphenyl)-2-morpholin-4-ylethyl]amino]cyclopent-2-en-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,4S)-4-[[1-(4-ethylphenyl)-2-morpholin-4-ylethyl]amino]cyclopent-2-en-1-yl]methanol?
The IUPAC name of [(1R,4S)-4-[[1-(4-ethylphenyl)-2-morpholin-4-ylethyl]amino]cyclopent-2-en-1-yl]methanol (CID 166210498) is [(1R,4S)-4-[[1-(4-ethylphenyl)-2-morpholin-4-ylethyl]amino]cyclopent-2-en-1-yl]methanol.
What is the SMILES notation for [(1R,4S)-4-[[1-(4-ethylphenyl)-2-morpholin-4-ylethyl]amino]cyclopent-2-en-1-yl]methanol?
The canonical SMILES for [(1R,4S)-4-[[1-(4-ethylphenyl)-2-morpholin-4-ylethyl]amino]cyclopent-2-en-1-yl]methanol is CCc1ccc(C(CN2CCOCC2)N[C@@H]2C=C[C@H](CO)C2)cc1.
What is the InChIKey of [(1R,4S)-4-[[1-(4-ethylphenyl)-2-morpholin-4-ylethyl]amino]cyclopent-2-en-1-yl]methanol?
The InChIKey is DUURDJSUUWPYEX-XRRBNZLQSA-N. The full InChI is InChI=1S/C20H30N2O2/c1-2-16-3-6-18(7-4-16)20(14-22-9-11-24-12-10-22)21-19-8-5-17(13-19)15-23/h3-8,17,19-21,23H,2,9-15H2,1H3/t17-,19+,20?/m0/s1.
What are the key properties of [(1R,4S)-4-[[1-(4-ethylphenyl)-2-morpholin-4-ylethyl]amino]cyclopent-2-en-1-yl]methanol?
[(1R,4S)-4-[[1-(4-ethylphenyl)-2-morpholin-4-ylethyl]amino]cyclopent-2-en-1-yl]methanol has a molecular weight of 330.47 g/mol, XLogP of 2.15, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,4S)-4-[[1-(4-ethylphenyl)-2-morpholin-4-ylethyl]amino]cyclopent-2-en-1-yl]methanol is sourced from PubChem (CID 166210498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).