C20H18Cl2N6O2 — CID 166210933
N,N'-bis(3-chloroimidazo[1,2-a]pyridin-6-yl)hexanediamide (PubChem CID 166210933) has the molecular formula C20H18Cl2N6O2 and a molecular weight of 445.31 g/mol. Its IUPAC name is N,N'-bis(3-chloroimidazo[1,2-a]pyridin-6-yl)hexanediamide.
| Compound Name | N,N'-bis(3-chloroimidazo[1,2-a]pyridin-6-yl)hexanediamide |
|---|---|
| PubChem CID | 166210933 |
| Molecular Formula | C20H18Cl2N6O2 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | N,N'-bis(3-chloroimidazo[1,2-a]pyridin-6-yl)hexanediamide |
| SMILES | O=C(CCCCC(=O)Nc1ccc2ncc(Cl)n2c1)Nc1ccc2ncc(Cl)n2c1 |
| InChI | InChI=1S/C20H18Cl2N6O2/c21-15-9-23-17-7-5-13(11-27(15)17)25-19(29)3-1-2-4-20(30)26-14-6-8-18-24-10-16(22)28(18)12-14/h5-12H,1-4H2,(H,25,29)(H,26,30) |
| InChIKey | KQBNMTCSFPHBQP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 92.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|