C17H18N4OS — CID 166211763
N-(1-piperidin-4-ylpyrazol-4-yl)-1-benzothiophene-5-carboxamide (PubChem CID 166211763) has the molecular formula C17H18N4OS and a molecular weight of 326.42 g/mol. Its IUPAC name is N-(1-piperidin-4-ylpyrazol-4-yl)-1-benzothiophene-5-carboxamide.
| Compound Name | N-(1-piperidin-4-ylpyrazol-4-yl)-1-benzothiophene-5-carboxamide |
|---|---|
| PubChem CID | 166211763 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | N-(1-piperidin-4-ylpyrazol-4-yl)-1-benzothiophene-5-carboxamide |
| SMILES | O=C(Nc1cnn(C2CCNCC2)c1)c1ccc2sccc2c1 |
| InChI | InChI=1S/C17H18N4OS/c22-17(13-1-2-16-12(9-13)5-8-23-16)20-14-10-19-21(11-14)15-3-6-18-7-4-15/h1-2,5,8-11,15,18H,3-4,6-7H2,(H,20,22) |
| InChIKey | NGFNOXSISZZULD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |