C26H29N5O2 — CID 166211896
N-[4-[2-(N-ethylanilino)-2-oxoethyl]phenyl]-2-piperidin-1-ylpyrimidine-4-carboxamide (PubChem CID 166211896) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-[4-[2-(N-ethylanilino)-2-oxoethyl]phenyl]-2-piperidin-1-ylpyrimidine-4-carboxamide.
| Compound Name | N-[4-[2-(N-ethylanilino)-2-oxoethyl]phenyl]-2-piperidin-1-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 166211896 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | N-[4-[2-(N-ethylanilino)-2-oxoethyl]phenyl]-2-piperidin-1-ylpyrimidine-4-carboxamide |
| SMILES | CCN(C(=O)Cc1ccc(NC(=O)c2ccnc(N3CCCCC3)n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H29N5O2/c1-2-31(22-9-5-3-6-10-22)24(32)19-20-11-13-21(14-12-20)28-25(33)23-15-16-27-26(29-23)30-17-7-4-8-18-30/h3,5-6,9-16H,2,4,7-8,17-19H2,1H3,(H,28,33) |
| InChIKey | RDDAWEJWQBPIHB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |