C20H26N2O4 — CID 166212876
N-[4-[(2,6-dioxopiperidin-1-yl)methyl]phenyl]-4,4-dimethyl-5-oxohexanamide (PubChem CID 166212876) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[4-[(2,6-dioxopiperidin-1-yl)methyl]phenyl]-4,4-dimethyl-5-oxohexanamide.
| Compound Name | N-[4-[(2,6-dioxopiperidin-1-yl)methyl]phenyl]-4,4-dimethyl-5-oxohexanamide |
|---|---|
| PubChem CID | 166212876 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-[4-[(2,6-dioxopiperidin-1-yl)methyl]phenyl]-4,4-dimethyl-5-oxohexanamide |
| SMILES | CC(=O)C(C)(C)CCC(=O)Nc1ccc(CN2C(=O)CCCC2=O)cc1 |
| InChI | InChI=1S/C20H26N2O4/c1-14(23)20(2,3)12-11-17(24)21-16-9-7-15(8-10-16)13-22-18(25)5-4-6-19(22)26/h7-10H,4-6,11-13H2,1-3H3,(H,21,24) |
| InChIKey | WGIOBCHANFBZCP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|