C19H21N3O2 — CID 16621373
(2,3,6-trimethylphenyl) 1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxylate (PubChem CID 16621373) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is (2,3,6-trimethylphenyl) 1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxylate.
| Compound Name | (2,3,6-trimethylphenyl) 1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 16621373 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (2,3,6-trimethylphenyl) 1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxylate |
| SMILES | Cc1cc(C(=O)Oc2c(C)ccc(C)c2C)c2c(C)nn(C)c2n1 |
| InChI | InChI=1S/C19H21N3O2/c1-10-7-8-11(2)17(13(10)4)24-19(23)15-9-12(3)20-18-16(15)14(5)21-22(18)6/h7-9H,1-6H3 |
| InChIKey | BZYHQFNWFWKKOO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|