C17H17FN2O2 — CID 166215044
3-ethyl-2-(5-fluoro-2-methoxyphenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 166215044) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is 3-ethyl-2-(5-fluoro-2-methoxyphenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | 3-ethyl-2-(5-fluoro-2-methoxyphenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 166215044 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 3-ethyl-2-(5-fluoro-2-methoxyphenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | CCN1C(=O)c2ccccc2NC1c1cc(F)ccc1OC |
| InChI | InChI=1S/C17H17FN2O2/c1-3-20-16(13-10-11(18)8-9-15(13)22-2)19-14-7-5-4-6-12(14)17(20)21/h4-10,16,19H,3H2,1-2H3 |
| InChIKey | PQQSRVSXRVWPSS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |