C16H20N4O2 — CID 166215428
N-[4-(4,5-dimethylimidazol-1-yl)phenyl]-N',N'-dimethylpropanediamide (PubChem CID 166215428) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is N-[4-(4,5-dimethylimidazol-1-yl)phenyl]-N',N'-dimethylpropanediamide.
| Compound Name | N-[4-(4,5-dimethylimidazol-1-yl)phenyl]-N',N'-dimethylpropanediamide |
|---|---|
| PubChem CID | 166215428 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[4-(4,5-dimethylimidazol-1-yl)phenyl]-N',N'-dimethylpropanediamide |
| SMILES | Cc1ncn(-c2ccc(NC(=O)CC(=O)N(C)C)cc2)c1C |
| InChI | InChI=1S/C16H20N4O2/c1-11-12(2)20(10-17-11)14-7-5-13(6-8-14)18-15(21)9-16(22)19(3)4/h5-8,10H,9H2,1-4H3,(H,18,21) |
| InChIKey | ZVOUQKWUKXPLKA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|