C20H20N4O2 — CID 166350114
3-[2-[4-(4,5-dimethylimidazol-1-yl)anilino]-2-oxoethyl]benzamide (PubChem CID 166350114) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 3-[2-[4-(4,5-dimethylimidazol-1-yl)anilino]-2-oxoethyl]benzamide.
| Compound Name | 3-[2-[4-(4,5-dimethylimidazol-1-yl)anilino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 166350114 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 3-[2-[4-(4,5-dimethylimidazol-1-yl)anilino]-2-oxoethyl]benzamide |
| SMILES | Cc1ncn(-c2ccc(NC(=O)Cc3cccc(C(N)=O)c3)cc2)c1C |
| InChI | InChI=1S/C20H20N4O2/c1-13-14(2)24(12-22-13)18-8-6-17(7-9-18)23-19(25)11-15-4-3-5-16(10-15)20(21)26/h3-10,12H,11H2,1-2H3,(H2,21,26)(H,23,25) |
| InChIKey | KOKKCSAVVBXLSR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |