C17H22N4O2 — CID 166305029
N'-[4-(4,5-dimethylimidazol-1-yl)phenyl]-2-ethyl-2-methylpropanediamide (PubChem CID 166305029) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is N'-[4-(4,5-dimethylimidazol-1-yl)phenyl]-2-ethyl-2-methylpropanediamide.
| Compound Name | N'-[4-(4,5-dimethylimidazol-1-yl)phenyl]-2-ethyl-2-methylpropanediamide |
|---|---|
| PubChem CID | 166305029 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N'-[4-(4,5-dimethylimidazol-1-yl)phenyl]-2-ethyl-2-methylpropanediamide |
| SMILES | CCC(C)(C(N)=O)C(=O)Nc1ccc(-n2cnc(C)c2C)cc1 |
| InChI | InChI=1S/C17H22N4O2/c1-5-17(4,15(18)22)16(23)20-13-6-8-14(9-7-13)21-10-19-11(2)12(21)3/h6-10H,5H2,1-4H3,(H2,18,22)(H,20,23) |
| InChIKey | MWXPPCJDODVKCS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|