C17H23N3O3 — CID 166215727
N-[4-(4,5-dimethylimidazol-1-yl)phenyl]-2-(2-methoxyethoxy)propanamide (PubChem CID 166215727) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[4-(4,5-dimethylimidazol-1-yl)phenyl]-2-(2-methoxyethoxy)propanamide.
| Compound Name | N-[4-(4,5-dimethylimidazol-1-yl)phenyl]-2-(2-methoxyethoxy)propanamide |
|---|---|
| PubChem CID | 166215727 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-[4-(4,5-dimethylimidazol-1-yl)phenyl]-2-(2-methoxyethoxy)propanamide |
| SMILES | COCCOC(C)C(=O)Nc1ccc(-n2cnc(C)c2C)cc1 |
| InChI | InChI=1S/C17H23N3O3/c1-12-13(2)20(11-18-12)16-7-5-15(6-8-16)19-17(21)14(3)23-10-9-22-4/h5-8,11,14H,9-10H2,1-4H3,(H,19,21) |
| InChIKey | CUACNFBJDSWKOG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|