C21H23F3N4O3 — CID 166216553
N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-1-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methanamine;2,2,2-trifluoroacetic acid (PubChem CID 166216553) has the molecular formula C21H23F3N4O3 and a molecular weight of 436.43 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-1-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methanamine;2,2,2-trifluoroacetic acid.
| Compound Name | N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-1-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166216553 |
| Molecular Formula | C21H23F3N4O3 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-1-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methanamine;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc2c(c1)CCCC2CNCc1cnc2cnccn12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H22N4O.C2HF3O2/c1-24-17-5-6-18-14(9-17)3-2-4-15(18)10-21-11-16-12-22-19-13-20-7-8-23(16)19;3-2(4,5)1(6)7/h5-9,12-13,15,21H,2-4,10-11H2,1H3;(H,6,7) |
| InChIKey | LKDSFZCKYRXBBS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |