C17H20N4O2 — CID 86839663
2-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-N'-pyrimidin-2-ylacetohydrazide (PubChem CID 86839663) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-N'-pyrimidin-2-ylacetohydrazide.
| Compound Name | 2-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-N'-pyrimidin-2-ylacetohydrazide |
|---|---|
| PubChem CID | 86839663 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-N'-pyrimidin-2-ylacetohydrazide |
| SMILES | COc1ccc2c(c1)CCCC2CC(=O)NNc1ncccn1 |
| InChI | InChI=1S/C17H20N4O2/c1-23-14-6-7-15-12(10-14)4-2-5-13(15)11-16(22)20-21-17-18-8-3-9-19-17/h3,6-10,13H,2,4-5,11H2,1H3,(H,20,22)(H,18,19,21) |
| InChIKey | LVVUHFUBMLOYFO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|