C22H38N4O2 — CID 166217159
3-(diethylamino)-N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]pyrrolidine-1-carboxamide (PubChem CID 166217159) has the molecular formula C22H38N4O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is 3-(diethylamino)-N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]pyrrolidine-1-carboxamide.
| Compound Name | 3-(diethylamino)-N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 166217159 |
| Molecular Formula | C22H38N4O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | 3-(diethylamino)-N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]pyrrolidine-1-carboxamide |
| SMILES | CCN(CC)C1CCN(C(=O)NCC(c2cccc(OC)c2)N(CC)CC)C1 |
| InChI | InChI=1S/C22H38N4O2/c1-6-24(7-2)19-13-14-26(17-19)22(27)23-16-21(25(8-3)9-4)18-11-10-12-20(15-18)28-5/h10-12,15,19,21H,6-9,13-14,16-17H2,1-5H3,(H,23,27) |
| InChIKey | MOVOCMYXNXCXFO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |