C15H19N3O3 — CID 166217948
N-phenylmethoxy-2-(1,3,5-trimethylpyrazol-4-yl)oxyacetamide (PubChem CID 166217948) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-phenylmethoxy-2-(1,3,5-trimethylpyrazol-4-yl)oxyacetamide.
| Compound Name | N-phenylmethoxy-2-(1,3,5-trimethylpyrazol-4-yl)oxyacetamide |
|---|---|
| PubChem CID | 166217948 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-phenylmethoxy-2-(1,3,5-trimethylpyrazol-4-yl)oxyacetamide |
| SMILES | Cc1nn(C)c(C)c1OCC(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C15H19N3O3/c1-11-15(12(2)18(3)16-11)20-10-14(19)17-21-9-13-7-5-4-6-8-13/h4-8H,9-10H2,1-3H3,(H,17,19) |
| InChIKey | HLTAGUSMMYIBPN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|