C18H24N4O2 — CID 99134606
(2S)-N-phenylmethoxy-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidine-1-carboxamide (PubChem CID 99134606) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (2S)-N-phenylmethoxy-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-phenylmethoxy-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 99134606 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (2S)-N-phenylmethoxy-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidine-1-carboxamide |
| SMILES | Cc1nn(C)c(C)c1[C@@H]1CCCN1C(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C18H24N4O2/c1-13-17(14(2)21(3)19-13)16-10-7-11-22(16)18(23)20-24-12-15-8-5-4-6-9-15/h4-6,8-9,16H,7,10-12H2,1-3H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | FUIYDMOLVIHMGC-INIZCTEOSA-N |
| XLogP | 3.02 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|