C22H23N3O — CID 166219485
(2,5-dimethylphenyl)-(4-isoquinolin-4-ylpiperazin-1-yl)methanone (PubChem CID 166219485) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is (2,5-dimethylphenyl)-(4-isoquinolin-4-ylpiperazin-1-yl)methanone.
| Compound Name | (2,5-dimethylphenyl)-(4-isoquinolin-4-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 166219485 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (2,5-dimethylphenyl)-(4-isoquinolin-4-ylpiperazin-1-yl)methanone |
| SMILES | Cc1ccc(C)c(C(=O)N2CCN(c3cncc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C22H23N3O/c1-16-7-8-17(2)20(13-16)22(26)25-11-9-24(10-12-25)21-15-23-14-18-5-3-4-6-19(18)21/h3-8,13-15H,9-12H2,1-2H3 |
| InChIKey | YXUBMYOZQJVFJP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |