C17H17NO5S — CID 166222433
3-[4-(2,3-dihydro-1-benzofuran-4-ylsulfamoyl)phenyl]propanoic acid (PubChem CID 166222433) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is 3-[4-(2,3-dihydro-1-benzofuran-4-ylsulfamoyl)phenyl]propanoic acid.
| Compound Name | 3-[4-(2,3-dihydro-1-benzofuran-4-ylsulfamoyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 166222433 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 3-[4-(2,3-dihydro-1-benzofuran-4-ylsulfamoyl)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(S(=O)(=O)Nc2cccc3c2CCO3)cc1 |
| InChI | InChI=1S/C17H17NO5S/c19-17(20)9-6-12-4-7-13(8-5-12)24(21,22)18-15-2-1-3-16-14(15)10-11-23-16/h1-5,7-8,18H,6,9-11H2,(H,19,20) |
| InChIKey | DJZIJESKAVMRHI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |