C21H23ClN2O4 — CID 166224732
3-[[3-[(2-chlorobenzoyl)amino]-3-phenylpropanoyl]-ethylamino]propanoic acid (PubChem CID 166224732) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is 3-[[3-[(2-chlorobenzoyl)amino]-3-phenylpropanoyl]-ethylamino]propanoic acid.
| Compound Name | 3-[[3-[(2-chlorobenzoyl)amino]-3-phenylpropanoyl]-ethylamino]propanoic acid |
|---|---|
| PubChem CID | 166224732 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 3-[[3-[(2-chlorobenzoyl)amino]-3-phenylpropanoyl]-ethylamino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)CC(NC(=O)c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C21H23ClN2O4/c1-2-24(13-12-20(26)27)19(25)14-18(15-8-4-3-5-9-15)23-21(28)16-10-6-7-11-17(16)22/h3-11,18H,2,12-14H2,1H3,(H,23,28)(H,26,27) |
| InChIKey | NVJNZKLNJDWLNQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |