C22H26ClN3O3 — CID 93235676
2-chloro-N-[(1S)-3-[2-(2-methylpropanoylamino)ethylamino]-3-oxo-1-phenylpropyl]benzamide (PubChem CID 93235676) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is 2-chloro-N-[(1S)-3-[2-(2-methylpropanoylamino)ethylamino]-3-oxo-1-phenylpropyl]benzamide.
| Compound Name | 2-chloro-N-[(1S)-3-[2-(2-methylpropanoylamino)ethylamino]-3-oxo-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 93235676 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 2-chloro-N-[(1S)-3-[2-(2-methylpropanoylamino)ethylamino]-3-oxo-1-phenylpropyl]benzamide |
| SMILES | CC(C)C(=O)NCCNC(=O)C[C@H](NC(=O)c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C22H26ClN3O3/c1-15(2)21(28)25-13-12-24-20(27)14-19(16-8-4-3-5-9-16)26-22(29)17-10-6-7-11-18(17)23/h3-11,15,19H,12-14H2,1-2H3,(H,24,27)(H,25,28)(H,26,29)/t19-/m0/s1 |
| InChIKey | OQLALTGWJKZKCO-IBGZPJMESA-N |
| XLogP | 3.09 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|