C21H26ClN3O4S — CID 46434139
2-chloro-N-[3-[3-[methyl(methylsulfonyl)amino]propylamino]-3-oxo-1-phenylpropyl]benzamide (PubChem CID 46434139) has the molecular formula C21H26ClN3O4S and a molecular weight of 451.98 g/mol. Its IUPAC name is 2-chloro-N-[3-[3-[methyl(methylsulfonyl)amino]propylamino]-3-oxo-1-phenylpropyl]benzamide.
| Compound Name | 2-chloro-N-[3-[3-[methyl(methylsulfonyl)amino]propylamino]-3-oxo-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 46434139 |
| Molecular Formula | C21H26ClN3O4S |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 2-chloro-N-[3-[3-[methyl(methylsulfonyl)amino]propylamino]-3-oxo-1-phenylpropyl]benzamide |
| SMILES | CN(CCCNC(=O)CC(NC(=O)c1ccccc1Cl)c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C21H26ClN3O4S/c1-25(30(2,28)29)14-8-13-23-20(26)15-19(16-9-4-3-5-10-16)24-21(27)17-11-6-7-12-18(17)22/h3-7,9-12,19H,8,13-15H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | WQAGDCPQVRHJHR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|