C21H20N2O3 — CID 166224769
1-[3-(1H-indol-3-yl)propanoylamino]-2,3-dihydroindene-1-carboxylic acid (PubChem CID 166224769) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-[3-(1H-indol-3-yl)propanoylamino]-2,3-dihydroindene-1-carboxylic acid.
| Compound Name | 1-[3-(1H-indol-3-yl)propanoylamino]-2,3-dihydroindene-1-carboxylic acid |
|---|---|
| PubChem CID | 166224769 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1-[3-(1H-indol-3-yl)propanoylamino]-2,3-dihydroindene-1-carboxylic acid |
| SMILES | O=C(CCc1c[nH]c2ccccc12)NC1(C(=O)O)CCc2ccccc21 |
| InChI | InChI=1S/C21H20N2O3/c24-19(10-9-15-13-22-18-8-4-2-6-16(15)18)23-21(20(25)26)12-11-14-5-1-3-7-17(14)21/h1-8,13,22H,9-12H2,(H,23,24)(H,25,26) |
| InChIKey | YEJVTYBICVHYOL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |