C19H17Cl2N3O2 — CID 166227770
(6-imidazol-1-yl-3-pyridinyl)methyl 4-(3,4-dichlorophenyl)butanoate (PubChem CID 166227770) has the molecular formula C19H17Cl2N3O2 and a molecular weight of 390.27 g/mol. Its IUPAC name is (6-imidazol-1-yl-3-pyridinyl)methyl 4-(3,4-dichlorophenyl)butanoate.
| Compound Name | (6-imidazol-1-yl-3-pyridinyl)methyl 4-(3,4-dichlorophenyl)butanoate |
|---|---|
| PubChem CID | 166227770 |
| Molecular Formula | C19H17Cl2N3O2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | (6-imidazol-1-yl-3-pyridinyl)methyl 4-(3,4-dichlorophenyl)butanoate |
| SMILES | O=C(CCCc1ccc(Cl)c(Cl)c1)OCc1ccc(-n2ccnc2)nc1 |
| InChI | InChI=1S/C19H17Cl2N3O2/c20-16-6-4-14(10-17(16)21)2-1-3-19(25)26-12-15-5-7-18(23-11-15)24-9-8-22-13-24/h4-11,13H,1-3,12H2 |
| InChIKey | ZCRPSBNABDCVNI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |