C13H18N4O3S — CID 166228071
(2R)-N-[(5-cyano-3-pyridinyl)sulfonyl]-2-(dimethylamino)-3-methylbutanamide (PubChem CID 166228071) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is (2R)-N-[(5-cyano-3-pyridinyl)sulfonyl]-2-(dimethylamino)-3-methylbutanamide.
| Compound Name | (2R)-N-[(5-cyano-3-pyridinyl)sulfonyl]-2-(dimethylamino)-3-methylbutanamide |
|---|---|
| PubChem CID | 166228071 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (2R)-N-[(5-cyano-3-pyridinyl)sulfonyl]-2-(dimethylamino)-3-methylbutanamide |
| SMILES | CC(C)[C@H](C(=O)NS(=O)(=O)c1cncc(C#N)c1)N(C)C |
| InChI | InChI=1S/C13H18N4O3S/c1-9(2)12(17(3)4)13(18)16-21(19,20)11-5-10(6-14)7-15-8-11/h5,7-9,12H,1-4H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | FOAMEIGKEZQNCN-GFCCVEGCSA-N |
| XLogP | 0.34 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |