C7H6N4O — CID 159088018
(5-cyano-3-pyridinyl)urea (PubChem CID 159088018) has the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. Its IUPAC name is (5-cyano-3-pyridinyl)urea.
| Compound Name | (5-cyano-3-pyridinyl)urea |
|---|---|
| PubChem CID | 159088018 |
| Molecular Formula | C7H6N4O |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | (5-cyano-3-pyridinyl)urea |
| SMILES | N#Cc1cncc(NC(N)=O)c1 |
| InChI | InChI=1S/C7H6N4O/c8-2-5-1-6(4-10-3-5)11-7(9)12/h1,3-4H,(H3,9,11,12) |
| InChIKey | KBRRYOPKPSTQKG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |