C20H18BrFN6O2 — CID 126592781
4-[2-amino-2-(3-bromo-4-fluorophenyl)iminoacetyl]-N-(5-cyano-3-pyridinyl)piperidine-1-carboxamide (PubChem CID 126592781) has the molecular formula C20H18BrFN6O2 and a molecular weight of 473.31 g/mol. Its IUPAC name is 4-[2-amino-2-(3-bromo-4-fluorophenyl)iminoacetyl]-N-(5-cyano-3-pyridinyl)piperidine-1-carboxamide.
| Compound Name | 4-[2-amino-2-(3-bromo-4-fluorophenyl)iminoacetyl]-N-(5-cyano-3-pyridinyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126592781 |
| Molecular Formula | C20H18BrFN6O2 |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | 4-[2-amino-2-(3-bromo-4-fluorophenyl)iminoacetyl]-N-(5-cyano-3-pyridinyl)piperidine-1-carboxamide |
| SMILES | N#Cc1cncc(NC(=O)N2CCC(C(=O)/C(N)=N/c3ccc(F)c(Br)c3)CC2)c1 |
| InChI | InChI=1S/C20H18BrFN6O2/c21-16-8-14(1-2-17(16)22)26-19(24)18(29)13-3-5-28(6-4-13)20(30)27-15-7-12(9-23)10-25-11-15/h1-2,7-8,10-11,13H,3-6H2,(H2,24,26)(H,27,30) |
| InChIKey | LIDAZAQEUSRTLK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 124.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|