C21H23BrFN5O3 — CID 145256925
4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[4-(methylamino)phenyl]piperidine-1-carboxamide (PubChem CID 145256925) has the molecular formula C21H23BrFN5O3 and a molecular weight of 492.35 g/mol. Its IUPAC name is 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[4-(methylamino)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[4-(methylamino)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 145256925 |
| Molecular Formula | C21H23BrFN5O3 |
| Molecular Weight | 492.35 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[4-(methylamino)phenyl]piperidine-1-carboxamide |
| SMILES | CNc1ccc(NC(=O)N2CCC(C(=O)/C(=N/c3ccc(F)c(Br)c3)NO)CC2)cc1 |
| InChI | InChI=1S/C21H23BrFN5O3/c1-24-14-2-4-15(5-3-14)26-21(30)28-10-8-13(9-11-28)19(29)20(27-31)25-16-6-7-18(23)17(22)12-16/h2-7,12-13,24,31H,8-11H2,1H3,(H,25,27)(H,26,30) |
| InChIKey | ZLVMVZQKFYNZLV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|