C18H19BrFN5O3S — CID 126593139
2-[4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]piperidin-1-yl]-N-methyl-1,3-thiazole-4-carboxamide (PubChem CID 126593139) has the molecular formula C18H19BrFN5O3S and a molecular weight of 484.35 g/mol. Its IUPAC name is 2-[4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]piperidin-1-yl]-N-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]piperidin-1-yl]-N-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 126593139 |
| Molecular Formula | C18H19BrFN5O3S |
| Molecular Weight | 484.35 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | 2-[4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]piperidin-1-yl]-N-methyl-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)c1csc(N2CCC(C(=O)/C(=N/c3ccc(F)c(Br)c3)NO)CC2)n1 |
| InChI | InChI=1S/C18H19BrFN5O3S/c1-21-17(27)14-9-29-18(23-14)25-6-4-10(5-7-25)15(26)16(24-28)22-11-2-3-13(20)12(19)8-11/h2-3,8-10,28H,4-7H2,1H3,(H,21,27)(H,22,24) |
| InChIKey | KGWXSKSWCUCUGU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|