About 2-(4-tert-butylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-4-carboxamide
2-(4-tert-butylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-4-carboxamide (PubChem CID 146633592) has the molecular formula C12H20N4O2S
and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-(4-tert-butylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(4-tert-butylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-4-carboxamide |
| PubChem CID | 146633592 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-(4-tert-butylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)(C)N1CCN(c2nc(C(=O)NO)cs2)CC1 |
| InChI | InChI=1S/C12H20N4O2S/c1-12(2,3)16-6-4-15(5-7-16)11-13-9(8-19-11)10(17)14-18/h8,18H,4-7H2,1-3H3,(H,14,17) |
| InChIKey | BJVHAKFCFCKSIP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-tert-butylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-(4-tert-butylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-4-carboxamide (CID 146633592) is 2-(4-tert-butylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-(4-tert-butylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-(4-tert-butylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-4-carboxamide is CC(C)(C)N1CCN(c2nc(C(=O)NO)cs2)CC1.
What is the InChIKey of 2-(4-tert-butylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-4-carboxamide?
The InChIKey is BJVHAKFCFCKSIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O2S/c1-12(2,3)16-6-4-15(5-7-16)11-13-9(8-19-11)10(17)14-18/h8,18H,4-7H2,1-3H3,(H,14,17).
What are the key properties of 2-(4-tert-butylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-4-carboxamide?
2-(4-tert-butylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-4-carboxamide has a molecular weight of 284.38 g/mol, XLogP of 1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 146633592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).