C21H21BrF2N4O3 — CID 126593163
4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[(4-fluorophenyl)methyl]piperidine-1-carboxamide (PubChem CID 126593163) has the molecular formula C21H21BrF2N4O3 and a molecular weight of 495.32 g/mol. Its IUPAC name is 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[(4-fluorophenyl)methyl]piperidine-1-carboxamide.
| Compound Name | 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[(4-fluorophenyl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126593163 |
| Molecular Formula | C21H21BrF2N4O3 |
| Molecular Weight | 495.32 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[(4-fluorophenyl)methyl]piperidine-1-carboxamide |
| SMILES | O=C(/C(=N/c1ccc(F)c(Br)c1)NO)C1CCN(C(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H21BrF2N4O3/c22-17-11-16(5-6-18(17)24)26-20(27-31)19(29)14-7-9-28(10-8-14)21(30)25-12-13-1-3-15(23)4-2-13/h1-6,11,14,31H,7-10,12H2,(H,25,30)(H,26,27) |
| InChIKey | GAZPUUUWDYJNMR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|