C19H20BrFN4O4S — CID 162650443
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-2-oxo-2-[1-(phenylsulfamoyl)piperidin-4-yl]ethanimidamide (PubChem CID 162650443) has the molecular formula C19H20BrFN4O4S and a molecular weight of 499.36 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-2-oxo-2-[1-(phenylsulfamoyl)piperidin-4-yl]ethanimidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-2-oxo-2-[1-(phenylsulfamoyl)piperidin-4-yl]ethanimidamide |
|---|---|
| PubChem CID | 162650443 |
| Molecular Formula | C19H20BrFN4O4S |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-2-oxo-2-[1-(phenylsulfamoyl)piperidin-4-yl]ethanimidamide |
| SMILES | O=C(/C(=N/c1ccc(F)c(Br)c1)NO)C1CCN(S(=O)(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C19H20BrFN4O4S/c20-16-12-15(6-7-17(16)21)22-19(23-27)18(26)13-8-10-25(11-9-13)30(28,29)24-14-4-2-1-3-5-14/h1-7,12-13,24,27H,8-11H2,(H,22,23) |
| InChIKey | PILGNNIWQIVIET-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|