C23H26BrFN6O4 — CID 145256911
4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-(6-morpholin-4-yl-3-pyridinyl)piperidine-1-carboxamide (PubChem CID 145256911) has the molecular formula C23H26BrFN6O4 and a molecular weight of 549.40 g/mol. Its IUPAC name is 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-(6-morpholin-4-yl-3-pyridinyl)piperidine-1-carboxamide.
| Compound Name | 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-(6-morpholin-4-yl-3-pyridinyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 145256911 |
| Molecular Formula | C23H26BrFN6O4 |
| Molecular Weight | 549.40 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-(6-morpholin-4-yl-3-pyridinyl)piperidine-1-carboxamide |
| SMILES | O=C(/C(=N/c1ccc(F)c(Br)c1)NO)C1CCN(C(=O)Nc2ccc(N3CCOCC3)nc2)CC1 |
| InChI | InChI=1S/C23H26BrFN6O4/c24-18-13-16(1-3-19(18)25)27-22(29-34)21(32)15-5-7-31(8-6-15)23(33)28-17-2-4-20(26-14-17)30-9-11-35-12-10-30/h1-4,13-15,34H,5-12H2,(H,27,29)(H,28,33) |
| InChIKey | NDSBMHYHTQIGGH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|