C21H22BrFN4O2S — CID 145256777
N-benzyl-4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]piperidine-1-carbothioamide (PubChem CID 145256777) has the molecular formula C21H22BrFN4O2S and a molecular weight of 493.40 g/mol. Its IUPAC name is N-benzyl-4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]piperidine-1-carbothioamide.
| Compound Name | N-benzyl-4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 145256777 |
| Molecular Formula | C21H22BrFN4O2S |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | N-benzyl-4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]piperidine-1-carbothioamide |
| SMILES | O=C(/C(=N/c1ccc(F)c(Br)c1)NO)C1CCN(C(=S)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H22BrFN4O2S/c22-17-12-16(6-7-18(17)23)25-20(26-29)19(28)15-8-10-27(11-9-15)21(30)24-13-14-4-2-1-3-5-14/h1-7,12,15,29H,8-11,13H2,(H,24,30)(H,25,26) |
| InChIKey | QPXPVWAKFPPAKG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|