C26H28BrFN6O5 — CID 126593061
4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[4-[1-[(2R)-2,3-dihydroxypropyl]pyrazol-4-yl]phenyl]piperidine-1-carboxamide (PubChem CID 126593061) has the molecular formula C26H28BrFN6O5 and a molecular weight of 603.45 g/mol. Its IUPAC name is 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[4-[1-[(2R)-2,3-dihydroxypropyl]pyrazol-4-yl]phenyl]piperidine-1-carboxamide.
| Compound Name | 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[4-[1-[(2R)-2,3-dihydroxypropyl]pyrazol-4-yl]phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126593061 |
| Molecular Formula | C26H28BrFN6O5 |
| Molecular Weight | 603.45 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[4-[1-[(2R)-2,3-dihydroxypropyl]pyrazol-4-yl]phenyl]piperidine-1-carboxamide |
| SMILES | O=C(/C(=N/c1ccc(F)c(Br)c1)NO)C1CCN(C(=O)Nc2ccc(-c3cnn(C[C@@H](O)CO)c3)cc2)CC1 |
| InChI | InChI=1S/C26H28BrFN6O5/c27-22-11-20(5-6-23(22)28)30-25(32-39)24(37)17-7-9-33(10-8-17)26(38)31-19-3-1-16(2-4-19)18-12-29-34(13-18)14-21(36)15-35/h1-6,11-13,17,21,35-36,39H,7-10,14-15H2,(H,30,32)(H,31,38)/t21-/m1/s1 |
| InChIKey | JQVGAKZGXFHRLO-OAQYLSRUSA-N |
| XLogP | 3.33 |
| TPSA | 152.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|