C22H23BrF2N4O3 — CID 126593602
4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[2-(4-fluorophenyl)ethyl]piperidine-1-carboxamide (PubChem CID 126593602) has the molecular formula C22H23BrF2N4O3 and a molecular weight of 509.35 g/mol. Its IUPAC name is 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[2-(4-fluorophenyl)ethyl]piperidine-1-carboxamide.
| Compound Name | 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[2-(4-fluorophenyl)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126593602 |
| Molecular Formula | C22H23BrF2N4O3 |
| Molecular Weight | 509.35 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[2-(4-fluorophenyl)ethyl]piperidine-1-carboxamide |
| SMILES | O=C(/C(=N/c1ccc(F)c(Br)c1)NO)C1CCN(C(=O)NCCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H23BrF2N4O3/c23-18-13-17(5-6-19(18)25)27-21(28-32)20(30)15-8-11-29(12-9-15)22(31)26-10-7-14-1-3-16(24)4-2-14/h1-6,13,15,32H,7-12H2,(H,26,31)(H,27,28) |
| InChIKey | IOEUIGIVPJTOGM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|